CAS 50-82-8: 2,4,5-Trichlorobenzoic acid
Formula:C7H3Cl3O2
InChI:InChI=1S/C7H3Cl3O2/c8-4-2-6(10)5(9)1-3(4)7(11)12/h1-2H,(H,11,12)
InChI key:InChIKey=PTFNNDHASFGWFI-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(Cl)C=C(Cl)C(Cl)=C1
Synonyms:- Ai3-33332
- Benzoic acid, 2,4,5-trichloro-
- Brn 1871922
- 2,4,5-Trichlorobenzoic acid
Sort by
Found 5 products.
2,4,5-Trichlorobenzoic acid
CAS:2,4,5-Trichlorobenzoic acidFormula:C7H3Cl3O2Purity:By hplc: 99.9% by area (Typical Value in Batch COA)Color and Shape: off-white powderMolecular weight:225.46g/mol2,4,5-Trichlorobenzoic acid
CAS:Formula:C7H3Cl3O2Purity:95%Color and Shape:SolidMolecular weight:225.45652,4,5-Trichlorobenzoic Acid
CAS:Controlled ProductApplications 2,4,5-trichlorobenzoic acid (cas# 50-82-8) is a useful research chemical.Formula:C7H3O2Cl3Color and Shape:NeatMolecular weight:225.452,4,5-Trichlorobenzoic acid
CAS:2,4,5-Trichlorobenzoic acid is a chlorinated aromatic compound that is used as a reagent in organic chemistry. It reacts with electron-rich arenes to form chloroarenes and can also be used to synthesize biphenyls. 2,4,5-Trichlorobenzoic acid is sensitive to light and can undergo photochemical reactions such as photolysis or electron-induced reactions. The reactive nature of this chemical makes it susceptible to mechanisms such as hydrolysis, oxidation or reduction. 2,4,5-Trichlorobenzoic acid has a constant boiling point of 246 degrees Celsius at atmospheric pressure.Formula:C7H3Cl3O2Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:225.46 g/mol
