![(5aS,12bS)-5a,12b-Dihydro-2,2-dimethyl-2H-[1,3]dioxolo[4,5-g]pyrano[2,3-c:6,5-f′]bis[1]benzopyran-…](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F362992-5as-12bs-5a-12b-dihydro-22-dimethyl-2h-13-dioxolo-45-g-pyrano-23-c-65-f-bis-1-benzopyran-13-6h-one.webp&w=3840&q=75)
CAS 50376-38-0: (5aS,12bS)-5a,12b-Dihydro-2,2-dimethyl-2H-[1,3]dioxolo[4,5-g]pyrano[2,3-c:6,5-f′]bis[1]benzopyran-13(6H)-one
Formula:C22H18O6
InChI:InChI=1S/C22H18O6/c1-22(2)6-5-11-14(28-22)4-3-12-20(23)19-13-7-16-17(26-10-25-16)8-15(13)24-9-18(19)27-21(11)12/h3-8,18-19H,9-10H2,1-2H3/t18-,19+/m1/s1
InChI key:InChIKey=TXNSUHKZCOMFPN-MOPGFXCFSA-N
SMILES:O=C1C=2C(=C3C(=CC2)OC(C)(C)C=C3)O[C@]4([C@@]1(C=5C(OC4)=CC6=C(C5)OCO6)[H])[H]
Synonyms:- (-)-Millettone
- (5aS,12bS)-5a,12b-Dihydro-2,2-dimethyl-2H-[1,3]dioxolo[4,5-g]pyrano[2,3-c:6,5-f′]bis[1]benzopyran-13(6H)-one
- 2H-[1,3]Dioxolo[4,5-g]pyrano[2,3-c:6,5-f′]bis[1]benzopyran-13(6H)-one, 5a,12b-dihydro-2,2-dimethyl-, (5aS,12bS)-
- 2H-[1,3]Dioxolo[4,5-g]pyrano[2,3-c:6,5-f′]bis[1]benzopyran-13(6H)-one, 5a,12b-dihydro-2,2-dimethyl-, (5aS-cis)-
- 2H-[1,3]dioxolo[6,7][1]benzopyrano[3,4-b]pyrano[2,3-h][1]benzopyran-13(6H)-one, 5a,12b-dihydro-2,2-dimethyl-, (5aS,12bS)-
- Milletton
Sort by
Found 1 products.
Millettone
CAS:Millettone is a novel organic compound, which is derived from natural botanical sources. It is an isoflavonoid extracted primarily from Millettia species, known for having a wide range of bioactive properties. With its unique chemical structure, Millettone effectively interacts with various biological systems, acting primarily through mechanisms that involve modulation of enzymatic activity and receptor binding. Such interactions can influence several biochemical pathways, promoting or inhibiting specific cellular processes. Millettone has garnered interest for its potential applications in pharmaceuticals, particularly in developing treatments for inflammatory conditions, due to its ability to modulate immune responses. Additionally, its antioxidant properties make it a subject of research in the context of neurodegenerative diseases, where oxidative stress is a critical factor. Studies continue to explore its efficacy and safety, investigating its role in cellular signaling and gene expression. Overall, Millettone represents a promising candidate in the quest for new therapeutic agents, driven by its multifaceted molecular interactions and biological effects.Formula:C22H18O6Purity:Min. 95%Molecular weight:378.37 g/mol