
CAS 50409-12-6: cis,cis-1,3,5-cyclohexanetriol dihydrate
Formula:C6H12O3
InChI:InChI=1/C6H12O3/c7-4-1-5(8)3-6(9)2-4/h4-9H,1-3H2/t4-,5+,6-
Synonyms:- (1S,3S,5S)-Cyclohexane-1,3,5-Triol
- cis-1,3,5-Cyclohexanetriol
Sort by
Found 4 products.
(1α,3α,5α)-1,3,5-Cyclohexanetriol
CAS:(1alpha,3alpha,5alpha)-1,3,5-Cyclohexanetriol is a cyclic oligomer of the sugar alcohol erythritol. It is a reactive molecule that is used in the synthesis of polyvinyl alcohol. (1alpha,3alpha,5alpha)-1,3,5-Cyclohexanetriol has been shown to have antimicrobial properties against bacteria and fungi. It can be synthesized in a reaction between ethylene glycol and hydrogen chloride gas. This product also reacts with water vapor to form hydrogen chloride gas and hydroxide ions. The hydroxide ions react with the cyclohexane ring to form an intramolecular hydrogen bond that stabilizes the molecule and prevents degradation by hydrochloric acid.Formula:C6H12O3Purity:Min. 95%Molecular weight:132.16 g/molRef: 3D-FC179511
Discontinued productCIS,CIS-1,3,5-CYCLOHEXANETRIOL DIHYDRATE
CAS:Formula:C6H16O5Purity:98%Color and Shape:SolidMolecular weight:168.1882(1α,3α,5α)-1,3,5-Cyclohexanetriol
CAS:Formula:C6H12O3Purity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:132.16Rel-(1S,3S,5S)-Cyclohexane-1,3,5-Triol
CAS:Rel-(1S,3S,5S)-Cyclohexane-1,3,5-TriolPurity:98%Molecular weight:132.16g/mol