
CAS 5042-03-5: 1,5,6-Trihydroxyxanthone
Formula:C13H8O5
InChI:InChI=1S/C13H8O5/c14-7-2-1-3-9-10(7)11(16)6-4-5-8(15)12(17)13(6)18-9/h1-5,14-15,17H
InChI key:InChIKey=QVQLOWQNIFSVLU-UHFFFAOYSA-N
SMILES:O=C1C=2C(OC=3C1=C(O)C=CC3)=C(O)C(O)=CC2
Synonyms:- 1,5,6-Trihydroxyxanthone
- 9H-xanthen-9-one, 1,5,6-trihydroxy-
- Mesuaxanthone B
- Xanthen-9-one, 1,5,6-trihydroxy-
- 1,5,6-Trihydroxy-9H-xanthen-9-one
Sort by
Found 2 products.
1,5,6-Trihydroxyxanthone
CAS:1,5,6-Trihydroxyxanthone is a natural xanthone derivative, which is commonly isolated from various plant sources, particularly in the family Gentianaceae. This compound is characterized by its polyhydroxylated xanthone structure, contributing to its diverse biological functionalities. Xanthones, including 1,5,6-Trihydroxyxanthone, are known for their ability to modulate oxidative pathways and interact with cellular signaling mechanisms. The mode of action of 1,5,6-Trihydroxyxanthone involves its antioxidant activity, where it scavenges free radicals, thereby protecting cellular components from oxidative damage. Furthermore, this compound may exhibit inhibition of enzymes involved in inflammatory pathways, suggesting potential anti-inflammatory effects. 1,5,6-Trihydroxyxanthone finds applications in various scientific fields, including pharmacological research, where it is investigated for its potential therapeutic effects. Studies focus on its roles in modulating oxidative stress, inflammation, and potentially contributing to cancer research due to its ability to influence cellular signaling pathways. This compound serves as a valuable subject for investigating natural products with potential health benefits.Formula:C13H8O5Purity:Min. 95%Molecular weight:244.2 g/mol1,5,6-Trihydroxyxanthone
CAS:1,5,6-Trihydroxyxanthone exhibits antibacterial activity against Gram-positive bacteria.Formula:C13H8O5Purity:98%Color and Shape:SolidMolecular weight:244.202