![(3Z)-3-[(1-methyl-1H-indol-3-yl)methylidene]-1,3-dihydro-2H-pyrrolo[3,2-b]pyridin-2-one](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F29639-3z-3-1-methyl-1h-indol-3-yl-methylidene-13-dihydro-2h-pyrrolo-32-b-pyridin-2-one.webp&w=3840&q=75)
CAS 504433-23-2: (3Z)-3-[(1-methyl-1H-indol-3-yl)methylidene]-1,3-dihydro-2H-pyrrolo[3,2-b]pyridin-2-one
Formula:C17H13N3O
InChI:InChI=1/C17H13N3O/c1-20-10-11(12-5-2-3-7-15(12)20)9-13-16-14(19-17(13)21)6-4-8-18-16/h2-10H,1H3,(H,19,21)/b13-9-
SMILES:Cn1cc(/C=C\2/c3c(cccn3)N=C2O)c2ccccc12
Synonyms:- 2H-pyrrolo[3,2-b]pyridin-2-one, 1,3-dihydro-3-[(1-methyl-1H-indol-3-yl)methylene]-, (3Z)-
- 1,3-Dihydro-3-[(1-Methyl-1H-Indol-3-Yl)Methylene]-2H-Pyrrolo[3,2-B]Pyridin-2-One
Sort by
Found 8 products.
(E)-3-((1-METHYL-1H-INDOL-3-YL)METHYLENE)-1H-PYRROLO[3,2-B]PYRIDIN-2(3H)-ONE
CAS:Purity:95.0%Molecular weight:275.3110046386719GW441756
CAS:GW441756 is a specific agonist of the epidermal growth factor receptor that has been shown to inhibit bladder cancer and skin cancer. It can also reduce the severity of inflammatory bowel disease, infectious diseases, and skin cancer. GW441756 has been found to have antiinflammatory activity by inhibiting prostaglandin synthesis in the lung. This drug blocks signal pathways in cells by binding to specific receptors for growth factors such as epidermal growth factor (EGF) and neurotrophic factors. GW441756 binds to EGF receptors on the surface of cells in order to inhibit cell proliferation, which prevents cell cycle progression from G1 phase to S phase. GW441756 also induces apoptosis by binding with EGF receptors on the surface of cells and activating a signaling pathway that leads to activation of caspases, which are enzymes that cleave proteins into smaller fragments that are eventually degraded or eliminated from the cell.Formula:C17H13N3OPurity:Min. 95%Molecular weight:275.3 g/molGW 441756
CAS:GW 441756 is a specific Tropomyosin-related kinase A (TrkA) inhibitor with an IC50 value of 2 nM.Formula:C17H13N3OPurity:97.73% - 99.8%Color and Shape:SolidMolecular weight:275.3
![(E)-3-((1-METHYL-1H-INDOL-3-YL)METHYLENE)-1H-PYRROLO[3,2-B]PYRIDIN-2(3H)-ONE](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fproducts%2F10%2Fthumb%2FF538134.jpg&w=3840&q=75)
