
CAS 51-27-4: 5-Ethyl-2-hydroxybenzoic acid
Formula:C9H10O3
InChI:InChI=1S/C9H10O3/c1-2-6-3-4-8(10)7(5-6)9(11)12/h3-5,10H,2H2,1H3,(H,11,12)
InChI key:InChIKey=WYIAFSIUYJGIPU-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(CC)=CC=C1O
Synonyms:- 5-Ethylsalicylic acid
- Benzoic acid, 5-ethyl-2-hydroxy-
- 5-Ethyl-2-hydroxybenzoic acid
- Salicylic acid, 5-ethyl-
Sort by
Found 4 products.
5-Ethyl-2-hydroxybenzoic acid
CAS:Formula:C9H10O3Purity:97%Color and Shape:SolidMolecular weight:166.17395-Ethyl-2-hydroxybenzoic acid
CAS:5-Ethyl-2-hydroxybenzoic acidPurity:95%Molecular weight:166.17g/mol5-Ethyl-2-hydroxybenzoic acid
CAS:5-Ethyl-2-hydroxybenzoic acid has the chemical nature of a phenol and is also known as salicylic acid. It is a monosubstituted aromatic carboxylic acid with a methoxy group. The hydroxyl group on this molecule interacts with the hydroxyl group on adjacent molecules to form hydrogen bonds, which gives it stability. Salicylic acid reacts with 4-methoxybenzoic acid to produce 2,4-dihydroxybenzoic acid and salicylic acid. Salicylic acid can also react with ascorbic acid to produce 2,5-dihydroxybenzoic acid and salicylic acid. Salicylic acid can also react with benzoic acids to produce 4-hydroxybenzoic and 2,4,6-trihydroxybenzoic acids.Formula:C9H10O3Purity:Min. 95%Molecular weight:166.18 g/mol