CAS 512-06-1: Yamogenin
Formula:C27H42O3
InChI:InChI=1S/C27H42O3/c1-16-7-12-27(29-15-16)17(2)24-23(30-27)14-22-20-6-5-18-13-19(28)8-10-25(18,3)21(20)9-11-26(22,24)4/h5,16-17,19-24,28H,6-15H2,1-4H3/t16-,17-,19-,20+,21-,22-,23-,24-,25-,26-,27+/m0/s1
InChI key:InChIKey=WQLVFSAGQJTQCK-CAKNJAFZSA-N
SMILES:C[C@@H]1[C@]2(O[C@@]3([C@]1([C@]4(C)[C@@](C3)([C@]5([C@](CC4)([C@]6(C)C(=CC5)C[C@@H](O)CC6)[H])[H])[H])[H])[H])CC[C@H](C)CO2
Synonyms:- (20Α,22R,25S)-Spirosta-5-Ene-3Β-Ol
- (22R,25S)-(20α)-Spirost-5-en-3β-ol
- (3beta,25S)-spirost-5-en-3-ol
- (3β,25S)-Spirost-5-en-3-ol
- 25-epi-Diosgenin
- Jamogenin
- Neodiosgenin
- Nsc 226132
- Spirost-5-en-3-ol, (3beta,25S)-
- Spirost-5-en-3-ol, (3β,25S)-
- Spirost-5-en-3β-ol, (25S)-
- See more synonyms
Sort by
Found 8 products.
Yamogenin
CAS:Oxygen-heterocyclic compoundFormula:C27H42O3Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:414.63(20α,22R,25S)-Spirosta-5-ene-3β-ol
CAS:Formula:C27H42O3Purity:70%Color and Shape:SolidMolecular weight:414.6205799999998Yamogenin - 70%
CAS:Yamogenin - 70% is a concentrated extract of the steroidal saponin known as yamogenin. It is derived primarily from species of the Dioscorea genus, commonly referred to as wild yams. The extraction process involves isolating the saponin component to achieve a purity level of 70%, making it suitable for specialized applications in scientific research and pharmaceutical development. The primary mode of action of yamogenin involves its role as a precursor in the synthesis of steroidal compounds, particularly those related to the production of hormones such as corticosteroids and contraceptive agents. Its structure enables it to undergo chemical transformations where the saponin backbone serves as a starting material for producing these vital compounds. In terms of applications, yamogenin - 70% is extensively utilized in the pharmaceutical industry for the semisynthesis of steroidal drugs. The versatility of yamogenin in chemical reactions makes it invaluable for developing hormone-related treatments. Additionally, its potential uses are being explored in various biotechnological applications, where the synthesis of complex molecules is required. This makes yamogenin - 70% a significant component in advancing medicinal chemistry and biotechnological innovations.Formula:C27H42O3Purity:Min. 70%Color and Shape:PowderMolecular weight:414.62 g/molYamogenin
CAS:Yamogenin is a diastereomer of diosgenin, which we have identified as the compound responsible for the anti-hyperlipidemic effect of fenugreek.Formula:C27H42O3Purity:99.87%Color and Shape:SolidMolecular weight:414.62
