
CAS 5127-64-0: Gallocatechin gallate
Formula:C22H18O11
InChI:InChI=1S/C22H18O11/c23-10-5-12(24)11-7-18(33-22(31)9-3-15(27)20(30)16(28)4-9)21(32-17(11)6-10)8-1-13(25)19(29)14(26)2-8/h1-6,18,21,23-30H,7H2/t18-,21+/m0/s1
InChI key:InChIKey=WMBWREPUVVBILR-GHTZIAJQSA-N
SMILES:O(C(=O)C1=CC(O)=C(O)C(O)=C1)[C@@H]2[C@H](OC=3C(C2)=C(O)C=C(O)C3)C4=CC(O)=C(O)C(O)=C4
Synonyms:- Gallocatechol gallate
- Benzoic acid, 3,4,5-trihydroxy-, 3,4-dihydro-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-2H-1-benzopyran-3-yl ester, (2R-trans)-
- Gallic acid, ester with gallocatechol
- Gallocatechol, 3-gallate
- Benzoic acid, 3,4,5-trihydroxy-, (2R,3S)-3,4-dihydro-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-2H-1-benzopyran-3-yl ester
Sort by
Found 3 products.
(+)-Gallocatechin gallate
CAS:(+)-Gallocatechin gallate analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C22H18O11Purity:(HPLC) ≥95%Color and Shape:PowderMolecular weight:458.38Gallocatechin gallate
CAS:Gallocatechin gallate is a flavonoid compound that can be isolated from the plant Gelsemium elegans and has antiviral activity.Formula:C22H18O11Purity:98.28%Color and Shape:SolidMolecular weight:458.37(+)-Gallocatechin gallate
CAS:(+)-Gallocatechin gallate is a polyphenolic compound, which is a specific type of catechin predominantly derived from green tea leaves, Camellia sinensis. It belongs to the flavonoid class of phytochemicals, known for their diverse biological activities. The compound exhibits potent antioxidant properties by scavenging free radicals and chelating metal ions, thereby reducing oxidative stress. It also modulates various signaling pathways involved in inflammation and cell proliferation. The uses of (+)-Gallocatechin gallate are extensive in scientific research, particularly in studies focusing on its potential role in preventing and treating diseases related to oxidative stress, such as cardiovascular diseases and neurodegenerative disorders. Furthermore, it is of interest in the field of cancer research due to its ability to induce apoptosis and inhibit cell growth in various cancer cell lines. These properties make it a valuable substance for exploring therapeutic applications and understanding the molecular mechanisms underpinning various health benefits.Formula:C22H18O11Purity:Min. 98 Area-%Color and Shape:White PowderMolecular weight:458.37 g/mol