
CAS 51876-18-7: 2,3-Dihydro-7,8-dihydroxy-2-phenyl-4H-1-benzopyran-4-one
Formula:C15H12O4
InChI:InChI=1S/C15H12O4/c16-11-7-6-10-12(17)8-13(19-15(10)14(11)18)9-4-2-1-3-5-9/h1-7,13,16,18H,8H2
InChI key:InChIKey=OXEDXEXEXGPMOG-UHFFFAOYSA-N
SMILES:OC1=C2C(C(=O)CC(O2)C3=CC=CC=C3)=CC=C1O
Synonyms:- 4H-1-Benzopyran-4-one, 2,3-dihydro-7,8-dihydroxy-2-phenyl-
- Flavanone, 7,8-dihydroxy-
- 7,8-Dihydroxyflavanone
- 2,3-Dihydro-7,8-dihydroxy-2-phenyl-4H-1-benzopyran-4-one
Sort by
Found 1 products.
7,8-Dihydroxyflavanone
CAS:7,8-Dihydroxyflavanone is a naturally occurring flavonoid compound, which is typically sourced from various plant species. This compound is structurally characterized by two hydroxyl groups, which are crucial for its biochemical activity. Its mode of action primarily involves the modulation of cellular signaling pathways, including those related to oxidative stress and enzyme inhibition. By interfering with these pathways, 7,8-Dihydroxyflavanone exerts antioxidant and possibly anti-inflammatory effects. In scientific research, this compound is of interest due to its potential therapeutic applications. Studies suggest that it may play a role in neuroprotection, suggesting uses in the treatment of neurodegenerative diseases such as Alzheimer's and Parkinson's. Additionally, its antioxidant properties are being explored for broader applications in reducing cellular damage caused by reactive oxygen species. Continued investigation into its bioavailability and mechanistic pathways could further elucidate its potential benefits and applications in pharmacology and medicine.Purity:Min. 95%