
CAS 51937-00-9: (9E,12Z)-9,12-Tetradecadien-1-ol
Formula:C14H26O
InChI:InChI=1S/C14H26O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15/h2-3,5-6,15H,4,7-14H2,1H3/b3-2-,6-5+
InChI key:InChIKey=IHRPKOQVBCPMQH-NDEAWQBTSA-N
SMILES:C(C/C=C/C/C=C\C)CCCCCCO
Synonyms:- (9E,12Z)-9,12-Tetradecadien-1-ol
- (9E,12Z)-Tetradecadien-1-ol
- (9E,12Z)-tetradeca-9,12-dien-1-ol
- (E,Z)-9,12-Tetradecadien-1-ol
- (trans,cis)-9-12-Tetradecadien-1-ol
- 9,12-(E,Z)-Tetradecadien-1-ol
- 9,12-Tetradecadien-1-ol, (9E,12Z)-
- 9,12-Tetradecadien-1-ol, (Z,E)-
- Ai3-34926
Sort by
Found 2 products.
(9E,12Z)-9,12-Tetradecadien-1-ol
CAS:(9E,12Z)-9,12-Tetradecadien-1-ol is a pheromone, which is a biochemical compound used for communication in the insect world. It is primarily sourced from various insect species, where it plays a crucial role in mating and behavioral signaling. The compound typically functions by mimicking the natural pheromones of specific insects, disrupting their mating patterns, or serving as an attractant for monitoring purposes. The primary application of (9E,12Z)-9,12-Tetradecadien-1-ol is in integrated pest management (IPM) systems. By incorporating this pheromone into monitoring traps or dispersal units, scientists can effectively track or control pest populations in agricultural settings. Its precise mechanism involves attracting specific insect species, allowing for targeted observation and intervention. As a result, this pheromone helps reduce reliance on chemical pesticides, promoting a more sustainable approach to pest control in crops. Additionally, its use is instrumental in research settings, where it aids in studying insect behavior and ecology.Formula:C14H26OPurity:Min. 95%Molecular weight:210.36 g/mol(9E,12Z)-9,12-Tetradecadienol
CAS:Controlled ProductFormula:C14H26OColor and Shape:NeatMolecular weight:210.356