
CAS 52009-53-7: 2-chloro-3,4-dimethoxybenzoic acid
Formula:C9H9ClO4
InChI:InChI=1/C9H9ClO4/c1-13-6-4-3-5(9(11)12)7(10)8(6)14-2/h3-4H,1-2H3,(H,11,12)
SMILES:COc1ccc(c(c1OC)Cl)C(=O)O
Sort by
Found 4 products.
2-Chloro- 3, 4 - dimethoxybenzoic acid
CAS:2-Chloro-3,4-dimethoxybenzoic acid is an electrophilic compound that is used as a reagent in organic synthesis. It reacts with nucleophiles such as aminoguanidine to form chlorinated products. This reaction is thermodynamically favorable due to the release of heat and the formation of a stable intermediate. 2-Chloro-3,4-dimethoxybenzoic acid also reacts with lithium ions at room temperature to form substituted derivatives. The regioselectivity of this reaction depends on the substituents present on the reactant.Formula:C9H9ClO4Purity:Min. 95%Molecular weight:216.62 g/mol2-Chloro-3,4-dimethoxybenzoic acid
CAS:Purity:97.0%Color and Shape:SolidMolecular weight:216.61999511718752-Chloro-3,4-dimethoxybenzoic acid
CAS:Formula:C9H9ClO4Purity:98%Color and Shape:SolidMolecular weight:216.618360000000022-Chloro-3,4-dimethoxybenzoic acid
CAS:2-Chloro-3,4-dimethoxybenzoic acidFormula:C9H9ClO4Purity:By hplc: 99.2% by area (Typical Value in Batch COA)Color and Shape: off white powderMolecular weight:216.62g/mol