CAS 521-32-4: Bilobetin
Formula:C31H20O10
InChI:InChI=1S/C31H20O10/c1-39-24-7-4-15(26-12-22(37)29-19(34)9-17(33)10-27(29)40-26)8-18(24)28-20(35)11-21(36)30-23(38)13-25(41-31(28)30)14-2-5-16(32)6-3-14/h2-13,32-36H,1H3
InChI key:InChIKey=IWEIJEPIYMAGTH-UHFFFAOYSA-N
SMILES:OC=1C(=C2C(C(=O)C=C(O2)C3=CC=C(O)C=C3)=C(O)C1)C4=C(OC)C=CC(=C4)C=5OC=6C(C(=O)C5)=C(O)C=C(O)C6
Synonyms:- 3′′′,8-Biflavone, 4′,5,5′′,7,7′′-pentahydroxy-4′′′-methoxy-
- 4H-1-benzopyran-4-one, 8-[5-(5,7-dihydroxy-4-oxo-4H-1-benzopyran-2-yl)-2-methoxyphenyl]-5,7-dihydroxy-2-(4-hydroxyphenyl)-
- 4′-Monomethylamentoflavone
- 4′-O-Methylamentoflavone
- 8-[5-(5,7-Dihydroxy-4-oxo-4H-1-benzopyran-2-yl)-2-methoxyphenyl]-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one
- Bilobetin
Sort by
Found 7 products.
Bilobetin
CAS:Bilobetin is a flavonoid compound, which is sourced from the leaves of the Ginkgo biloba tree. This compound primarily functions through its antioxidative properties, influencing a variety of neural pathways. Its mode of action involves the scavenging of reactive oxygen species and modulation of cellular signaling pathways that impact synaptic transmission and neuroplasticity. Bilobetin is extensively studied for its potential neuroprotective applications, particularly in neurodegenerative conditions. Its ability to influence cognitive functions makes it a subject of interest in Alzheimer’s disease research, where it is investigated for enhancing memory and learning abilities. Additionally, due to its antioxidative capabilities, it is explored in studies related to oxidative stress-linked conditions. Scientists are particularly interested in Bilobetin's potential to cross the blood-brain barrier, making it a significant compound in pharmacological research aimed at targeting central nervous system disorders.Purity:Min. 95%Bilobetin
CAS:Bilobetin ameliorates insulin resistance by PKA-mediated phosphorylation of PPARα in rats fed a high-fat diet.Formula:C31H20O10Purity:97.74% - 99.73%Color and Shape:SolidMolecular weight:552.48Ref: TM-T4S2128
1mg47.00€2mg70.00€5mg144.00€10mg250.00€25mg424.00€50mg613.00€100mg843.00€1mL*10mM (DMSO)187.00€Bilobetin
CAS:Oxygen-heterocyclic compoundFormula:C31H20O10Purity:≥ 85.0 % (HPLC)Color and Shape:PowderMolecular weight:552.48
