![(16R)-7,16-dimethyl-6,8,9,16-tetrahydrobis[1,3]benzodioxolo[4,5-c:5',6'-g]azecin-15(7H)-one](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F316214-16r-716-dimethyl-68916-tetrahydrobis-13-benzodioxolo-45-c-5-6-g-azecin-15-7h-one.webp&w=3840&q=75)
CAS 521-85-7: (16R)-7,16-dimethyl-6,8,9,16-tetrahydrobis[1,3]benzodioxolo[4,5-c:5',6'-g]azecin-15(7H)-one
Formula:C21H21NO5
InChI:InChI=1/C21H21NO5/c1-12-14-3-4-17-21(27-11-24-17)16(14)9-22(2)6-5-13-7-18-19(26-10-25-18)8-15(13)20(12)23/h3-4,7-8,12H,5-6,9-11H2,1-2H3/t12-/m1/s1
SMILES:C[C@@H]1c2ccc3c(c2CN(C)CCc2cc4c(cc2C1=O)OCO4)OCO3
Synonyms:- 521-85-7
- Corycavamine
- Corycavine
Sort by
Found 1 products.
Corycavine
CAS:Corycavine is an alkaloid compound, which is derived from certain species of Corydalis plants, particularly from their roots. This naturally occurring substance acts primarily as an alpha-adrenoceptor antagonist, modulating adrenergic signaling pathways. By competitively inhibiting the binding of endogenous catecholamines such as norepinephrine, it influences vascular tone and other physiological processes mediated by alpha-adrenergic receptors. Corycavine is employed in pharmacological research to understand alpha-adrenergic receptor functions and to explore potential therapeutic avenues for conditions like hypertension, where modulation of vascular resistance is crucial. Its role in experimental settings allows scientists to dissect adrenergic mechanisms and develop novel therapeutic strategies. Understanding the pharmacokinetics and specific interactions of Corycavine with cellular targets is vital for elucidating its impact within biological systems, potentially guiding the development of future adrenergic modulators.Formula:C21H21NO5Purity:Min. 95%Color and Shape:PowderMolecular weight:367.4 g/mol