
CAS 5233-04-5: 3,5-dichlorobenzene-1,2-diamine
Formula:C6H6Cl2N2
InChI:InChI=1/C6H6Cl2N2/c7-3-1-4(8)6(10)5(9)2-3/h1-2H,9-10H2
SMILES:c1c(cc(c(c1Cl)N)N)Cl
Synonyms:- 1,2-Benzenediamine, 3,5-Dichloro-
Sort by
Found 4 products.
"3,5-Dichlorobenzene-1,2-Diamine"
CAS:"3,5-Dichlorobenzene-1,2-Diamine"Purity:99%Molecular weight:177.03g/mol3,5-Dichlorobenzene-1,2-diamine
CAS:Formula:C6H6Cl2N2Purity:97%Color and Shape:SolidMolecular weight:177.031240000000033,5-Dichloro-1,2-diaminobenzene
CAS:3,5-Dichloro-1,2-diaminobenzene is a ligand that binds to transition metal ions such as nickel. It has been shown to be an effective inhibitor of the syncytial virus in cell culture. The synthesis of 3,5-dichloro-1,2-diaminobenzene from 3,5-dichloroaniline and hydrochloric acid can be achieved using the following reaction: 3,5-Dichloroaniline + HCl → 3,5-Dichloro-1,2-diaminobenzene + HNO3 This compound is also a precursor for the synthesis of pyrazole derivatives.Formula:C6H6Cl2N2Purity:Min. 95%Molecular weight:177.03 g/mol