
CAS 524731-02-0: 5-methylthiophene-3-carbohydrazide
Formula:C6H8N2OS
InChI:InChI=1/C6H8N2OS/c1-4-2-5(3-10-4)6(9)8-7/h2-3H,7H2,1H3,(H,8,9)
SMILES:Cc1cc(cs1)C(=NN)O
Synonyms:- 3-Thiophenecarboxylic Acid, 5-Methyl-, Hydrazide
Sort by
Found 3 products.
3-Thiophenecarboxylicacid,5-methyl-,hydrazide(9CI)
CAS:Formula:C6H8N2OSPurity:97%Molecular weight:156.20555-Methylthiophene-3-carbohydrazide
CAS:5-Methylthiophene-3-carbohydrazide is a white powder that is soluble in water and ethanol. It is used as a reagent for organic synthesis, especially for the production of heterocycles. The chemical name for 5-methylthiophene-3-carbohydrazide is methyl 3-(aminocarbonyl)-5-methylthiophenecarboxylate. It has a molecular weight of 160.06 grams per mole and a melting point of 35°C. It reacts with acid to form an N-methylthiophthalimide, which can then be reacted with various amines to produce diverse products. This compound is also used as a building block in the synthesis of complex molecules such as pharmaceuticals, agrochemicals, or fragrances.Formula:C6H8N2OSPurity:Min. 95 Area-%Color and Shape:PowderMolecular weight:156.21 g/mol