
CAS 52480-43-0: 4,5-Dimethyl-2-furaldehyde
Formula:C7H8O2
InChI:InChI=1/C7H8O2/c1-5-3-7(4-8)9-6(5)2/h3-4H,1-2H3
SMILES:Cc1cc(C=O)oc1C
Synonyms:- 2-Furancarboxaldehyde, 4,5-dimethyl-
- 4,5-Dimethylfuran-2-Carbaldehyde
- 4,5-Dimethyl-2-furaldehyde
Sort by
Found 4 products.
4,5-Dimethylfuran-2-carbaldehyde
CAS:Formula:C7H8O2Purity:97%Color and Shape:LiquidMolecular weight:124.13724,5-Dimethyl-2-furaldehyde
CAS:4,5-Dimethyl-2-furaldehydeFormula:C7H8O2Purity:95Color and Shape: clear. yellow liquidMolecular weight:124.14g/mol4,5-Dimethyl-2-furancarboxaldehyde
CAS:4,5-Dimethyl-2-furancarboxaldehyde is a phenyl compound that is found in the synthesis of 5-hydroxymethylfurfural. It has been shown to be an influential chemical that can promote carcinogenic activity and inhibit ptp1b. 4,5-Dimethyl-2-furancarboxaldehyde may also influence the formation of adducts with DNA and proteins. This chemical has been shown to have carcinogenic potential through its ability to react with nitrite in the stomach to form nitrosamines, which are known carcinogens.Formula:C10H8N2O2Purity:Min. 95%Color and Shape:PowderMolecular weight:124.14 g/mol