
CAS 52771-99-0: 5-Nitro-1,3-dihydroisobenzofuran
Formula:C8H7NO3
InChI:InChI=1/C8H7NO3/c10-9(11)8-2-1-6-4-12-5-7(6)3-8/h1-3H,4-5H2
SMILES:c1cc(cc2COCc12)N(=O)=O
Synonyms:- 5-Nitrophthalan
- 5-Nitro-1,3-Dihydro-2-Benzofuran
Sort by
Found 3 products.
5-Nitro-1,3-dihydroisobenzofuran
CAS:Formula:C8H7NO3Purity:95%Color and Shape:SolidMolecular weight:165.14611,3-Dihydro-5-nitro-isobenzofuran
CAS:1,3-Dihydro-5-nitro-isobenzofuran is a chemical compound that is used as a probe for metal cations in biological samples. 1,3-Dihydro-5-nitro-isobenzofuran has been shown to be activated by hydroxide and p-hydroxybenzoic acid, which generate the corresponding nitrite anion and the corresponding hydroxybenzoate anion. This reaction is catalyzed by aerobacter aerogenes. The nitrite anion can be detected with probes labeled with colorants such as phenol red or 2,4-dinitrophenylhydrazine. In this way, 1,3-dihydro-5-nitroisobenzofuran can be used to detect the presence of iron ions in biological samples such as blood or urine.Formula:C8H7NO3Purity:Min. 95%Molecular weight:165.15 g/molRef: 3D-FD150751
Discontinued productRef: 10-F469000
1gTo inquire2gTo inquire5gTo inquire10gTo inquire100mgTo inquire250mgTo inquire500mgTo inquire