
CAS 52978-83-3: 2,3,4-trimethoxy-6-nitrobenzaldehyde
Formula:C10H11NO6
InChI:InChI=1/C10H11NO6/c1-15-8-4-7(11(13)14)6(5-12)9(16-2)10(8)17-3/h4-5H,1-3H3
SMILES:COc1cc(c(C=O)c(c1OC)OC)N(=O)=O
Synonyms:- 2,3,4-Trimethoxy-6-nitrobenzolcarbaldehyd
- Benzaldehyde, 2,3,4-Trimethoxy-6-Nitro-
Sort by
Found 3 products.
2,3,4-trimethoxy-6-nitrobenzaldehyde
CAS:Color and Shape:Solid, Yellow powderMolecular weight:241.199005126953122,3,4-TRIMETHOXY-6-NITROBENZALDEHYDE
CAS:Formula:C10H11NO6Purity:97%Color and Shape:SolidMolecular weight:241.19742,3,4-Trimethoxy-6-nitrobenzaldehyde
CAS:2,3,4-Trimethoxy-6-nitrobenzaldehyde is a methoxylated heterocycle that is expressed as an acyl group in the reaction. It can be demethylated to form 2,3,4-trimethoxybenzaldehyde. The methoxy groups on the aromatic rings make this molecule more electrophilic and reactive than 2,3,4-trimethoxybenzaldehyde. The systematic reaction rate of this molecule is faster than that of 2,3,4-trimethoxybenzaldehyde due to its methoxylation and aromatic amino groups. The chemical shift for this molecule is different from that of 2,3,4-trimethoxybenzaldehyde because it has two methoxy groups instead of one.Formula:C10H11NO6Purity:Min. 95%Molecular weight:241.2 g/molRef: 3D-FT132299
Discontinued product