![1-benzyl-2'-(4-methoxyphenyl)-9'-methyl-1',10b'-dihydrospiro[piperidine-4,5'-pyrazolo[1,5-c][1,3]b…](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F363546-1-benzyl-2-4-methoxyphenyl-9-methyl-1-10b-dihydrospiro-piperidine-45-pyrazolo-15-c-13-benzoxazine.webp&w=3840&q=75)
CAS 5304-71-2: 1-benzyl-2'-(4-methoxyphenyl)-9'-methyl-1',10b'-dihydrospiro[piperidine-4,5'-pyrazolo[1,5-c][1,3]benzoxazine]
Formula:C29H31N3O2
InChI:InChI=1/C29H31N3O2/c1-21-8-13-28-25(18-21)27-19-26(23-9-11-24(33-2)12-10-23)30-32(27)29(34-28)14-16-31(17-15-29)20-22-6-4-3-5-7-22/h3-13,18,27H,14-17,19-20H2,1-2H3
SMILES:Cc1ccc2c(c1)C1CC(=NN1C1(CCN(CC1)Cc1ccccc1)O2)c1ccc(cc1)OC
Sort by
Found 6 products.
Morellic acid
CAS:Morellic acid inhibits HUVEC migration at 0.5 μM and has anti-cancer and antiangiogenic properties.Formula:C33H36O8Purity:99.43% - 99.85%Color and Shape:SolidMolecular weight:560.63Ref: TM-TN1112
1mg90.00€5mg183.00€10mg311.00€25mg525.00€50mg750.00€100mg1,026.00€1mL*10mM (DMSO)244.00€Morellic acid
CAS:Formula:C33H36O8Purity:(HPLC) ≥ 98.0%Color and Shape:Orange to brown powderMolecular weight:560.64Morellic acid
CAS:Oxygen-heterocyclic compoundFormula:C33H36O8Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:560.63Morellic acid
CAS:Morellic acid has anti-cancer activity, it strongly inhibited the migration of HUVEC at a low concentration of 0.5 µM in HUVEC cell migration assay in vitro. Morellic acid also has antiangiogenic activity.Formula:C33H36O8Purity:95%~99%Color and Shape:PowderMolecular weight:560.643Morellic acid
CAS:Morellic acid is a naturally occurring compound that is classified as an organic acid, specifically a depsidone. It is derived primarily from the lichen species of the Parmelia genus. Lichens are symbiotic associations between fungi and photosynthetic organisms, typically algae or cyanobacteria, found in a variety of environmental conditions. The mode of action of morellic acid is primarily attributed to its antimicrobial properties. It disrupts the cell walls of bacteria and fungi, leading to cell death. This action is facilitated by its ability to interfere with the synthesis of essential cellular components. Morellic acid is used in scientific research exploring its potential as an antimicrobial agent. Its applications extend to the study of natural product chemistry, especially in understanding the ecological role of lichens in inhibiting the growth of competing microorganisms in their environment. Furthermore, morellic acid serves as a model compound in the development of synthetic derivatives aimed at enhancing antimicrobial efficacy for potential therapeutic uses.Purity:Min. 95%
