
CAS 53135-24-3: ethyl 4-hydroxy-2-methylpyrimidine-5-carboxylate
Formula:C8H10N2O3
InChI:InChI=1/C8H10N2O3/c1-3-13-8(12)6-4-9-5(2)10-7(6)11/h4H,3H2,1-2H3,(H,9,10,11)
SMILES:CCOC(=O)c1cnc(C)nc1O
Synonyms:- 4-Hydroxy-2-Methyl-Pyrimidine-5-Carboxylic Acid Ethyl Ester
Sort by
Found 3 products.
4-Hydroxy-2-methyl-pyrimidine-5-carboxylic acid ethyl ester
CAS:4-Hydroxy-2-methyl-pyrimidine-5-carboxylic acid ethyl ester is a potent inhibitor of human telomerase. The enzyme telomerase is involved in the synthesis of telomeres, which are repetitive DNA sequences at the ends of chromosomes that protect the chromosomes from deterioration or from fusion with other chromosomes. Telomeres shorten during each cell division, and eventually become too short to protect the chromosome. This leads to chromosomal instability and cell death. 4-Hydroxy-2-methyl-pyrimidine-5-carboxylic acid ethyl ester inhibits human telomerase by binding to it and preventing telomere replication. This drug has been shown to inhibit tumor growth in mice when used in combination with chemotherapy drugs.Formula:C8H10N2O3Purity:Min. 95%Molecular weight:182.18 g/mol4-Hydroxy-2-methyl-pyrimidine-5-carboxylic acid ethyl ester
CAS:Purity:98.0%Color and Shape:Solid, NeedlesMolecular weight:182.17900085449224-HYDROXY-2-METHYL-PYRIMIDINE-5-CARBOXYLIC ACID ETHYL ESTER
CAS:Formula:C8H10N2O3Purity:95%Color and Shape:SolidMolecular weight:182.1766