
CAS 5320-91-2: methyl 4-(4-methoxycarbonylphenyl)azobenzoate
Formula:C16H14N2O4
InChI:InChI=1/C16H14N2O4/c1-21-15(19)11-3-7-13(8-4-11)17-18-14-9-5-12(6-10-14)16(20)22-2/h3-10H,1-2H3
SMILES:COC(=O)c1ccc(cc1)N=Nc1ccc(cc1)C(=O)OC
Synonyms:- Benzoic Acid, 4,4'-(1,2-Diazenediyl)Bis-, Dimethyl Ester
- Dimethyl 4,4'-diazene-1,2-diyldibenzoate
- Azobenzene-4,4'-Dicarboxylic Acid Dimethyl Ester
Sort by
Found 4 products.
Dimethyl Azobenzene-4,4'-dicarboxylate
CAS:Dimethyl Azobenzene-4,4'-dicarboxylate is a compound with aromatic properties. It is a derivative of benzoin and can be synthesized from nitrobenzaldehyde and cyanoformaldehyde. The compound is an electron donating reagent that reacts with ketones to form aromatic aldehydes. Dimethyl Azobenzene-4,4'-dicarboxylate has been shown to react with the hydroxyl group of nitrobenzaldehyde to form a dimethyl nitrobenzene intermediate. This reaction is catalyzed by copper. The reaction can be summarized as follows: Cyanide ion + electron -> Cyanide Dimethyl Azobenzene-4,4'-dicarboxylate + Ketone -> Aromatic AldehydeFormula:C16H14N2O4Purity:Min. 95%Molecular weight:298.3 g/molDimethyl Azobenzene-4,4'-dicarboxylate
CAS:Formula:C16H14N2O4Purity:>95.0%(GC)Color and Shape:Light yellow to Brown powder to crystalMolecular weight:298.30DIMETHYL AZOBENZENE-4,4'-DICARBOXYLATE
CAS:Purity:95%Color and Shape:SolidMolecular weight:298.298004150391AZOBENZENE-4,4'-DICARBOXYLIC ACID DIMETHYL ESTER
CAS:Formula:C16H14N2O4Purity:95%Color and Shape:SolidMolecular weight:298.2934