
CAS 5331-42-0: 3-amino-2-benzyl-3-oxopropanoic acid
Formula:C10H8NO2
InChI:InChI=1/C10H9NO2/c11-7-9(10(12)13)6-8-4-2-1-3-5-8/h1-5,9H,6H2,(H,12,13)/p-1/t9-/m1/s1
SMILES:c1ccc(cc1)C[C@H](C#N)C(=O)[O-]
Synonyms:- 2-Cyano-3-Phenylpropanoic Acid
- (2S)-2-cyano-3-phenylpropanoate
- (2R)-2-cyano-3-phenylpropanoate
Sort by
Found 4 products.
2-Cyano-3-phenylpropionic acid
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:175.186996459960942-CYANO-3-PHENYLPROPIONIC ACID
CAS:Formula:C10H9NO2Purity:97%Color and Shape:SolidMolecular weight:175.1842-Cyano-3-phenylpropionic acid
CAS:2-Cyano-3-phenylpropionic acidPurity:95%Molecular weight:175.18g/mol2-Cyano-3-phenylpropionic acid
CAS:2-Cyano-3-phenylpropionic acid is a chiral, enantiomerically pure chemical that is used in the production of acrylates. This compound was first synthesized by the reaction of thionyl chloride with 2-cyano-3-phenylpropionic acid. The stereoselective synthesis of this compound was achieved by a liquid crystal composition, which produced a high yield and enantiopure product. 2-Cyano-3-phenylpropionic acid has been shown to inhibit polymerase chain reactions (PCR) in vitro, but does not inhibit DNA replication in vivo. It also inhibits the enzyme flavin monooxygenase at high concentrations and can be used as an intermediate for the synthesis of drugs such as acetaminophen.Formula:C10H9NO2Purity:Min. 95%Molecular weight:175.19 g/mol