
CAS 5331-92-0: 3,4-dichlorobenzaldehyde oxime
Formula:C7H5Cl2NO
InChI:InChI=1/C7H5Cl2NO/c8-6-2-1-5(4-10-11)3-7(6)9/h1-4,11H/b10-4+
Synonyms:- 3,4-Dichlorobenzaldoxime
Sort by
Found 4 products.
3,4-Dichlorobenzaldehyde oxime
CAS:3,4-Dichlorobenzaldehyde oxime is a natural carotenoid that has been shown to have antibacterial activity. 3,4-Dichlorobenzaldehyde oxime is produced by the reaction of malonate and aldehyde in an incubated system. This compound has been shown to be active against Gram-positive bacteria such as staphylococcus and aldoximes and Gram-negative bacteria such as E. coli, Salmonella typhimurium, and Shigella flexneri. 3,4-Dichlorobenzaldehyde oxime inhibits bacterial growth by binding to the 50S ribosomal subunit of the bacterial cell membrane. This binding prevents protein synthesis, leading to cell death. The biosynthesis of 3,4-dichlorobenzaldehyde oxime involves the conversion of abscisic acid (ABA) into ABA quinone through oxidation by an enzyme called ABA oxidaseFormula:C7H5Cl2NOPurity:Min. 95%Color and Shape:PowderMolecular weight:190.03 g/mol3,4-dichlorobenzaldehyde oxime
CAS:3,4-dichlorobenzaldehyde oximePurity:95Molecular weight:190.03g/mol