
CAS 53369-17-8: (-)-Myrtanol
Formula:C10H18O
InChI:InChI=1S/C10H18O/c1-10(2)8-4-3-7(6-11)9(10)5-8/h7-9,11H,3-6H2,1-2H3/t7-,8+,9+/m1/s1
InChI key:InChIKey=LDWAIHWGMRVEFR-VGMNWLOBSA-N
SMILES:CC1(C)[C@@]2([C@@H](CO)CC[C@]1(C2)[H])[H]
Synonyms:- ((1S,2S,5S)-6,6-Dimethylbicyclo[3.1.1]-heptan-2-yl)methanol
- (-)-Myrtanol
- (1S)-Myrtanol
- (1S,2S,5S)-()-Myrtanol
- (1S,2S,5S)-6,6-Dimethylbicyclo[3.1.1]heptane-2-methanol
- Bicyclo[3.1.1]heptane-2-methanol, 6,6-dimethyl-, (1S,2S,5S)-
- Bicyclo[3.1.1]heptane-2-methanol, 6,6-dimethyl-, [1S-(1α,2α,5α)]-
- [(1S,2S,5S)-6,6-dimethylbicyclo[3.1.1]hept-2-yl]methanol
- [(2S)-trans]-(1S,5S)-6,6-Dimethylbicyclo[3,1,1]heptan-2-yl-methanol
- ()-trans-Myrtanol
Sort by
Found 3 products.
(-)-trans-Myrtanol
CAS:(-)-trans-Myrtanol is a type of monoterpenoid, classified as a terpene alcohol. It is primarily derived from essential oils found in various plants, including those in the coniferous and Lauraceae families. Myrtanol is a chiral compound, and its stereochemistry is vital for its biological activities. The mode of action of (-)-trans-Myrtanol involves its interaction with cellular membranes and proteins, where it can influence various biochemical pathways. As a terpene, it may modulate membrane fluidity and affect enzyme activities, impacting processes such as oxidative stress response and signal transduction. In scientific research, (-)-trans-Myrtanol is utilized for its antimicrobial, anti-inflammatory, and antioxidant properties. It serves as a valuable compound in studies exploring natural product chemistry and pharmacology. Additionally, the compound's role as a fragrance component is investigated in the context of olfactory science. The study of (-)-trans-Myrtanol contributes to the understanding of terpene biochemistry and its potential therapeutic applications.Formula:C10H18OPurity:Min. 95%Color and Shape:Colorless Clear LiquidMolecular weight:154.25 g/mol(-)-trans-Myrtanol
CAS:(-)-trans-Myrtanol analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C10H18OPurity:(GC) ≥98% (sum of enantiomers)Color and Shape:LiquidMolecular weight:154.25(-)-TRANS-MYRTANOL
CAS:(-)-TRANS-MYRTANOL exhibited potent antimicrobial activities.Formula:C10H18OPurity:98%Color and Shape:SolidMolecular weight:154.25