
CAS 5349-24-6: N-butyl-2-chloroacetamide
Formula:C6H12ClNO
InChI:InChI=1/C6H12ClNO/c1-2-3-4-8-6(9)5-7/h2-5H2,1H3,(H,8,9)
SMILES:CCCCN=C(CCl)O
Synonyms:- Acetamide, N-butyl-2-chloro-
- N-Butyl-2-chloroacetamide
Sort by
Found 4 products.
N-BUTYL-2-CHLORO-ACETAMIDE
CAS:Formula:C6H12ClNOPurity:97%Color and Shape:LiquidMolecular weight:149.6186N-Butyl-2-chloroacetamide
CAS:N-Butyl-2-chloroacetamide is a coordination compound that binds to metal ions. It has been shown to have binding constants of 1.5 x 10 M for magnesium, and 2.0 x 10 M for zinc. N-Butyl-2-chloroacetamide is also a spiropyran, which is an acetone derivative that has a fluorescence emission spectrum. The kinetic constants for the formation of the transition states are determined by measuring the decoloration rate and the fluorescence emission intensity at various concentrations of the chemical in acetone. The absorption and emission spectra of N-butyl-2-chloroacetamide are determined using photochromic constants, which are constants that describe how quickly a material changes color when exposed to light or heat.Formula:C6H12ClNOPurity:Min. 95%Molecular weight:149.62 g/mol