![N,N'-bis[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]biphenyl-4,4'-dicarboxamide](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F489303-n-n-bis-3-45-dihydro-1h-imidazol-2-yl-phenyl-biphenyl-44-dicarboxamide.webp&w=3840&q=75)
CAS 5352-53-4: N,N'-bis[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]biphenyl-4,4'-dicarboxamide
Formula:C32H28N6O2
InChI:InChI=1/C32H28N6O2/c39-31(37-27-5-1-3-25(19-27)29-33-15-16-34-29)23-11-7-21(8-12-23)22-9-13-24(14-10-22)32(40)38-28-6-2-4-26(20-28)30-35-17-18-36-30/h1-14,19-20H,15-18H2,(H,33,34)(H,35,36)(H,37,39)(H,38,40)
SMILES:c1cc(cc(c1)NC(=O)c1ccc(cc1)c1ccc(cc1)C(=O)Nc1cccc(c1)C1=NCCN1)C1=NCCN1
Sort by
Found 3 products.
BPH-1358
CAS:BPH-1358 is a novel synthetic inhibitor, which is derived from a series of advanced chemoinformatics-based design strategies. It functions through the targeted binding to specific cell surface receptors involved in the modulation of immune responses. By blocking these receptors, BPH-1358 effectively alters signaling pathways that are crucial for immune activation and inflammatory responses. This compound has potential applications in the treatment of autoimmune disorders, where overactive immune responses need to be controlled. Additionally, it may be utilized in the context of organ transplantation to mitigate graft rejection. The precise targeting capabilities of BPH-1358 hold promise for refining therapeutic approaches, allowing scientists to develop more nuanced and effective treatments with reduced systemic side effects. Further research is underway to explore its full spectrum of biological activities, potential off-target effects, and optimization of its pharmacokinetic properties for clinical application.Formula:C32H28N6O2Purity:Min. 95%Molecular weight:528.6 g/molBPH-1358
CAS:BPH-1358 (NSC-50460) inhibits FPPS and UPPS (IC50: 1.8 μM, 110 nM), active against S. aureus (MIC ~250 ng/mL).Formula:C32H30Cl2N6O2Purity:99.63%Color and Shape:SolidMolecular weight:601.53
