
CAS 53823-02-2: 4-hydroxy-6-(2-hydroxyethyl)-2,2,5,7-tetramethyl-2,3-dihydro-1H-inden-1-one
Formula:C15H20O3
InChI:InChI=1/C15H20O3/c1-8-10(5-6-16)9(2)13(17)11-7-15(3,4)14(18)12(8)11/h16-17H,5-7H2,1-4H3
SMILES:Cc1c(CCO)c(C)c(c2CC(C)(C)C(=O)c12)O
Synonyms:- 1H-inden-1-one, 2,3-dihydro-4-hydroxy-6-(2-hydroxyethyl)-2,2,5,7-tetramethyl-
Sort by
Found 4 products.
Onitin
CAS:Onitin shows super-oxide and DPPH free radical scavenging effects.It also exhibits hepatoprotective activity on tacrine-induced cytotoxicity in human liver-Formula:C15H20O3Purity:98%Color and Shape:SolidMolecular weight:248.32Onitin
CAS:Onitin is a synthetic chemical compound classified as an enzyme inhibitor, which is derived from extensive laboratory synthesis processes involving advanced organic chemistry techniques. Its mode of action involves the targeted binding to specific active sites of enzymes, leading to the modulation or inhibition of the enzyme's activity. This action mechanism facilitates detailed study and understanding of enzyme functions and metabolic pathways. In biochemical research, Onitin is primarily used to investigate cellular processes, particularly those related to enzymatic activity and regulation. Through its inhibitory effects, researchers can delineate enzyme roles in various biological systems, contributing valuable insights into metabolic disorders, drug development, and therapeutic interventions. Additionally, Onitin serves as a crucial tool in pharmacological studies aimed at elucidating potential drug targets and assessing the biochemical impact of enzyme inhibition within complex biological environments.Formula:C15H20O3Purity:Min. 95%Molecular weight:248.32 g/mol