
CAS 53981-69-4: 1-(1H-imidazol-2-yl)ethanone
Formula:C5H6N2O
InChI:InChI=1/C5H6N2O/c1-4(8)5-6-2-3-7-5/h2-3H,1H3,(H,6,7)
SMILES:CC(=O)c1[nH]ccn1
Synonyms:- Ethanone, 1-(1H-imidazol-2-yl)-
Sort by
Found 5 products.
1-(1H-Imidazol-2-yl)ethanone
CAS:Controlled ProductFormula:C5H6N2OColor and Shape:Off-WhiteMolecular weight:110.1142-Acetylimidazole
CAS:2-AcetylimidazolePurity:97%Color and Shape:Pale Yellow To Brown SolidMolecular weight:110.11g/mol1-(1H-Imidazol-2-yl)ethanone
CAS:1-(1H-Imidazol-2-yl)ethanone is a molecule that binds to the cell factor and inhibits the growth of mammalian cells. It also inhibits glycogen synthase kinase-3, which has been implicated in insulin resistance and cancer. The carbonyl group allows for binding to hydrochloric acid and amide groups. This compound has shown inhibitory effects on cervical cancer cells.Formula:C5H6N2OPurity:Min. 95%Molecular weight:110.11 g/molRef: 3D-FI129808
Discontinued product1-(1H-imidazol-2-yl)ethanone
CAS:Formula:C5H6N2OPurity:95%Color and Shape:SolidMolecular weight:110.1139