
CAS 5411-70-1: Tetrabromoterephthalicacid; 98%
Formula:C8H2Br4O4
InChI:InChI=1/C8H2Br4O4/c9-3-1(7(13)14)4(10)6(12)2(5(3)11)8(15)16/h(H,13,14)(H,15,16)
SMILES:c1(c(c(c(c(c1Br)Br)C(=O)O)Br)Br)C(=O)O
Sort by
Found 5 products.
TETRABROMOTEREPHTHALIC ACID
CAS:Formula:C8H2Br4O4Purity:98%Color and Shape:SolidMolecular weight:481.7151Tetrabromoterephthalic acid
CAS:Tetrabromoterephthalic acid is a polycarboxylic acid with antireflection properties and a supramolecular structure. It has been used to make form compounds, which are materials that change shape when exposed to certain stimuli such as light or temperature. Tetrabromoterephthalic acid also exhibits fluorescence properties and can be used in dye-sensitized solar cells. The compound contains an ethyl group and carbonyl group, which act as functional groups. Tetrabromoterephthalic acid also contains hydrogen bonding interactions and hydroxyl groups, which participate in hydrogen bonding interactions.Formula:C8H2Br4O4Purity:Min. 95%Color and Shape:PowderMolecular weight:481.71 g/mol2,3,5,6-Tetrabromoterephthalic Acid
CAS:2,3,5,6-Tetrabromoterephthalic AcidPurity:98%Molecular weight:481.72g/molTetrabromoterephthalic Acid
CAS:Controlled ProductFormula:C8H2Br4O4Color and Shape:NeatMolecular weight:481.72