CAS 545-48-2: (+)-Erythrodiol
Formula:C30H50O2
InChI:InChI=1S/C30H50O2/c1-25(2)14-16-30(19-31)17-15-28(6)20(21(30)18-25)8-9-23-27(5)12-11-24(32)26(3,4)22(27)10-13-29(23,28)7/h8,21-24,31-32H,9-19H2,1-7H3/t21-,22-,23+,24-,27-,28+,29+,30+/m0/s1
InChI key:InChIKey=PSZDOEIIIJFCFE-OSQDELBUSA-N
SMILES:C[C@]12C([C@]3([C@@](CO)(CC1)CCC(C)(C)C3)[H])=CC[C@]4([C@@]2(C)CC[C@@]5([C@]4(C)CC[C@H](O)C5(C)C)[H])[H]
Synonyms:- (+)-Erythrodiol
- (3β)-Olean-12-ene-3,28-diol
- Olean-12-ene-3β,28-diol
- Olean-12-ene-3,28-diol, (3β)-
- Erythrodiol
Sort by
Found 10 products.
Erythrodiol
CAS:Controlled ProductErythrodiol is a pentacyclic triterpenoid alcohol, which is primarily derived from the hydrolysis of oleanolic acid, found predominantly in the leaves and fruits of the olive tree, Olea europaea. As a bioactive compound, it plays a significant role in various biological processes due to its potent antioxidant, anti-inflammatory, and cardioprotective properties. Erythrodiol's mode of action involves modulating oxidative stress and inflammatory pathways. It achieves this through the scavenging of free radicals, inhibiting enzymes involved in inflammation, and modulating cellular signaling pathways that reduce oxidative damage and inflammatory responses. This compound shows promise in the protection of cellular structures from oxidative damage and in the modulation of inflammatory signaling cascades. The uses and applications of erythrodiol are extensive in scientific research, where it is investigated for its therapeutic potential in conditions such as cardiovascular diseases, certain cancers, and inflammatory disorders. Its presence in olive oil is often linked to the beneficial health effects associated with the Mediterranean diet, highlighting its potential in wellness and preventive healthcare studies.Formula:C30H50O2Purity:Min. 97 Area-%Color and Shape:PowderMolecular weight:442.72 g/molOlean-12-ene-3,28-diol, (3b)-
CAS:Formula:C30H50O2Purity:98%Color and Shape:SolidMolecular weight:442.7168Erythrodiol
CAS:Cyclic alcoholFormula:C30H50O2Purity:≥ 90.0 % (GC)Color and Shape:PowderMolecular weight:442.72Erythrodiol
CAS:Erythrodiol analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C30H50O2Purity:(HPLC) ≥97%Color and Shape:PowderMolecular weight:442.73Erythrodiol
CAS:Erythrodiol, an olive oil component, promotes Cholesterol efflux (ChE) by selectively inhibiting the degradation of ABCA1 protein.Formula:C30H50O2Purity:99.52% - 99.8%Color and Shape:SolidMolecular weight:442.72
