![2-cyano-N-(2,4-dimethylphenyl)-3-(2-{2-[(4-methoxyphenyl)amino]-2-oxoethoxy}phenyl)prop-2-enamide](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F390506-2-cyano-n-24-dimethylphenyl-3-2-2-4-methoxyphenyl-amino-2-oxoethoxy-phenyl-prop-2-enamide.webp&w=3840&q=75)
CAS 5456-71-3: 2-cyano-N-(2,4-dimethylphenyl)-3-(2-{2-[(4-methoxyphenyl)amino]-2-oxoethoxy}phenyl)prop-2-enamide
Formula:C27H25N3O4
InChI:InChI=1/C27H25N3O4/c1-18-8-13-24(19(2)14-18)30-27(32)21(16-28)15-20-6-4-5-7-25(20)34-17-26(31)29-22-9-11-23(33-3)12-10-22/h4-15H,17H2,1-3H3,(H,29,31)(H,30,32)
SMILES:Cc1ccc(c(C)c1)N=C(C(=Cc1ccccc1OCC(=O)Nc1ccc(cc1)OC)C#N)O
Sort by
Found 1 products.
Pomiferin-3',4'-dimethylether
CAS:Pomiferin-3',4'-dimethylether is a natural flavonoid compound, which is isolated from plants such as the Osage orange (Maclura pomifera). This compound is derived through meticulous extraction techniques that preserve its bioactive properties. As a methylated derivative of pomiferin, it exhibits a unique mode of action characterized by its interaction with various cellular pathways. These interactions enable it to exert antioxidant, anti-inflammatory, and potential antimicrobial effects, making it a subject of significant interest in medicinal chemistry and pharmacognosy. The study of pomiferin-3',4'-dimethylether focuses on its potential applications in enhancing health through its innate ability to modulate oxidative stress and inflammatory responses. Current research explores its applicability in developing therapeutic interventions for conditions linked to oxidative damage and chronic inflammation. Scientists are particularly keen on understanding its molecular mechanisms to harness its capabilities in creating novel pharmaceuticals or nutraceuticals, emphasizing its role in contributing to health and disease prevention strategies.Formula:C27H28O6Purity:Min. 95%Molecular weight:448.51 g/mol