
CAS 5458-06-0: 5-(4-Hydroxybutyl)-2,4-imidazolidinedione
Formula:C7H12N2O3
InChI:InChI=1S/C7H12N2O3/c10-4-2-1-3-5-6(11)9-7(12)8-5/h5,10H,1-4H2,(H2,8,9,11,12)
InChI key:InChIKey=SQKDMDCPJJTKKB-UHFFFAOYSA-N
SMILES:C(CCCO)C1NC(=O)NC1=O
Synonyms:- 2,4-Imidazolidinedione, 5-(4-Hydroxybutyl)-
- 5-(4-Hydroxybutyl)-2,4-imidazolidinedione
- 5-(4-Hydroxybutyl)hydantoin
- 5-(ω-Hydroxybutyl)hydantoin
- Hydantoin, 5-(4-hydroxybutyl)-
- NSC 16534
- NSC 23788
- 5-(4-Hydroxybutyl)imidazolidine-2,4-dione
Sort by
Found 5 products.
5-delta-Hydroxybutylhydantoin
CAS:5-delta-Hydroxybutylhydantoin is a specialized chemical compound, classified within the category of hydantoins. Derived synthetically, it is designed to interact at a molecular level, offering unique properties through its hydroxy functionality, which can participate in hydrogen bonding and alter physical properties in complex systems. This compound operates by integrating into polymer matrices, potentially modifying mechanical properties such as flexibility and tensile strength. Its hydrophilic nature may enhance the compatibility of hydrophobic polymers with aqueous environments. In scientific applications, 5-delta-Hydroxybutylhydantoin is explored in the development of advanced polymer systems, including biodegradable plastics and hydrogels. Its presence in formulations can lead to novel material characteristics, potentially impacting sectors such as biomedical device manufacturing, sustainable packaging, and environmentally friendly materials. Researchers focus on its ability to fine-tune properties of polymers, facilitating innovations in materials science.Formula:C7H12N2O3Purity:Min. 95%Molecular weight:172.18 g/mol5-(4-Hydroxybutyl)imidazolidine-2,4-dione
CAS:5-(4-Hydroxybutyl)imidazolidine-2,4-dioneMolecular weight:172.18g/mol5-d-Hydroxybutylhydantoin
CAS:Formula:C7H12N2O3Purity:97%Color and Shape:SolidMolecular weight:172.181779999999975-Delta-Hydroxybutylhydantoin
CAS:Controlled ProductApplications 5-δ-Hydroxybutylhydantoin (cas# 5458-06-0) is a compound useful in organic synthesis. References Can. J. Res., 26B, 387 (1948)Formula:C7H12N2O3Color and Shape:NeatMolecular weight:172.18