
CAS 5472-99-1: 1-chloro-3-methoxy-2-nitrobenzene
Formula:C7H6ClNO3
InChI:InChI=1/C7H6ClNO3/c1-12-6-4-2-3-5(8)7(6)9(10)11/h2-4H,1H3
SMILES:COc1cccc(c1N(=O)=O)Cl
Synonyms:- 3-Chloro-2-nitrophenyl methyl ether
- Benzene, 1-Chloro-3-Methoxy-2-Nitro-
- 1-Chloro-3-methoxy-2-nitrobenzene
Sort by
Found 4 products.
1-Chloro-3-methoxy-2-nitrobenzene
CAS:1-Chloro-3-methoxy-2-nitrobenzene is an anomalous compound that reacts with water to produce hydrochloric acid and nitrous oxide. The reaction starts with cleavage of the C-C bond, followed by a rearrangement to form the methylenedioxy group. This leads to a nucleophilic attack on the aromatic ring, which causes it to become electrophilic and react with water. The temperature of this reaction is dependent on the concentration of hydrochloric acid.Formula:C7H6ClNO3Purity:Min. 95%Molecular weight:187.58 g/mol1-chloro-3-methoxy-2-nitro-benzene
CAS:Formula:C7H6ClNO3Purity:96%Color and Shape:SolidMolecular weight:187.58044000000004