CAS 548-03-8: Protohypericin
Formula:C30H18O8
InChI:InChI=1S/C30H18O8/c1-9-3-11-19(13(31)5-9)29(37)25-17(35)7-15(33)23-24-16(34)8-18(36)26-28(24)22(21(11)27(23)25)12-4-10(2)6-14(32)20(12)30(26)38/h3-8,31-36H,1-2H3
InChI key:InChIKey=YLILOANQCQKPOD-UHFFFAOYSA-N
SMILES:OC=1C=2C3=C(C4=C5C2C(O)=CC(O)=C5C(=O)C=6C4=CC(C)=CC6O)C=7C(C(=O)C3=C(O)C1)=C(O)C=C(C)C7
Synonyms:- 1,3,4,6,8,15-Hexahydroxy-10,13-dimethyl-dibenzo[a,o]perylene-7,16-dione
- Dibenzo[a,o]perylene-7,16-dione, 1,3,4,6,8,15-hexahydroxy-10,13-dimethyl-
- Helianthrone, 1,3,4,6,8,15-hexahydroxy-10,13-dimethyl-
- Protohypericin
- 1,3,4,6,8,15-Hexahydroxy-10,13-dimethyldibenzo[a,o]perylene-7,16-dione
Sort by
Found 7 products.
Protohypericin
CAS:Protohypericin exhibits photocytotoxicity.Formula:C30H18O8Purity:95%~99%Molecular weight:506.466Protohypericin
CAS:Protohypericin analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C30H18O8Purity:(HPLC) ≥90%Color and Shape:PowderMolecular weight:506.47Protohypericin
CAS:Protohypericin is a photosensitizer, which is a compound known for its ability to absorb light and induce a photodynamic response. This compound is derived from the plant Hypericum perforatum, commonly known as St. John's Wort. The primary mode of action of protohypericin involves the absorption of specific wavelengths of light, leading to the generation of reactive oxygen species (ROS). These ROS are capable of inducing cell death, primarily through mechanisms such as apoptosis and necrosis. The applications of protohypericin are significant in the field of photodynamic therapy (PDT), an area of research that investigates the treatment of various cancers and bacterial infections using light-activated compounds. When exposed to light, protohypericin activates and targets malignant or pathogenic cells, making it a powerful tool in the treatment of tumors and microbial infections. Its natural origin and unique ability to induce photochemical responses make protohypericin a subject of intense study in therapeutic research, with ongoing investigations into optimizing its efficacy and broadening its range of applications.Formula:C30H18O8Purity:Min. 95%Color and Shape:PowderMolecular weight:506.46 g/molProtohypericin
CAS:Protohypericin, a naphthodianthrone derivative found in the plant Hypericum perforatum, exhibits photocytotoxicity and is utilized in tumor necrosis targetedFormula:C30H18O8Purity:95% - 98.52%Color and Shape:SolidMolecular weight:506.46
