
CAS 54928-05-1: Phytolaccagenic acid
Formula:C31H48O6
InChI:InChI=1S/C31H48O6/c1-26(25(36)37-6)13-15-31(24(34)35)16-14-29(4)19(20(31)17-26)7-8-22-27(2)11-10-23(33)28(3,18-32)21(27)9-12-30(22,29)5/h7,20-23,32-33H,8-18H2,1-6H3,(H,34,35)/t20-,21+,22+,23-,26-,27-,28-,29+,30+,31-/m0/s1
InChI key:InChIKey=YAGYBNOEVSEGSL-HGDAMUQJSA-N
SMILES:C(O)(=O)[C@]12[C@](C=3[C@](C)([C@@]4(C)[C@](CC3)([C@]5(C)[C@@](CC4)([C@@](CO)(C)[C@@H](O)CC5)[H])[H])CC1)(C[C@](C(OC)=O)(C)CC2)[H]
Synonyms:- (3Beta)-3,23-Dihydroxy-30-Methoxy-30-Oxoolean-12-En-28-Oic Acid
- Olean-12-Ene-28,30-Dioic Acid, 3,23-Dihydroxy-, 30-Methyl Ester, (3Beta)-
- Olean-12-ene-28,29-dioic acid, 3,23-dihydroxy-, 29-methyl ester, (3β,4α,20β)-
- Phytolaccagenic Acid
- Phytolaccinic acid
Sort by
Found 4 products.
Phytolaccinic acid
CAS:Controlled ProductPhytolaccinic acid is a naturally occurring compound found in the plant species Phytolacca americana, commonly known as pokeweed. This phytochemical is sourced from the roots and berries of the plant, where it naturally accumulates. The mode of action of phytolaccinic acid is thought to involve interactions with cellular pathways that regulate inflammation and immune responses, although the precise mechanisms remain a subject of ongoing research. Phytolaccinic acid is primarily investigated for its potential applications in the field of pharmacology, particularly for its anti-inflammatory and immunomodulatory properties. Experimental studies have suggested its utility in the development of therapeutic agents for conditions characterized by chronic inflammation. However, its use is still largely experimental, requiring further validation through rigorous scientific studies. Additional research is necessary to fully elucidate its pharmacokinetics, therapeutic window, and safety profile. Current applications are limited to laboratory research settings, where it serves as a compound of interest for deeper molecular investigations into its biological effects.Formula:C31H48O6Purity:Min. 95%Color and Shape:White Off-White PowderMolecular weight:516.71 g/molPhytolaccagenic acid
CAS:Phytolaccagenic acid is a natural productFormula:C31H48O6Purity:98%Color and Shape:SolidMolecular weight:516.71