
CAS 5513-66-6: 4-Amino-2-piperidinone
Formula:C5H10N2O
InChI:InChI=1/C5H10N2O/c6-4-1-2-7-5(8)3-4/h4H,1-3,6H2,(H,7,8)
SMILES:C1CN=C(CC1N)O
Synonyms:- 2-Piperidinone, 4-Amino-
- 4-Aminopiperidin-2-on
- 4-Aminopiperidin-2-one
- 4-AMino-2-piperidinone trifluoroacetate
Sort by
Found 3 products.
4-Amino-2-piperidinone
CAS:4-Amino-2-piperidinone is a peptidomimetic that binds to dopamine receptors. It has been shown to bind to dopamine receptors in rat brain tissue, and this binding can lead to the modulation of neurotransmitter release. 4-Amino-2-piperidinone has also been shown to inhibit the growth of bacteria by alkylating bacterial DNA and preventing transcription. This drug was synthesized from β-amino acid, which is a building block for proteins. The synthesis of 4-Amino-2-piperidinone involves an intramolecular hydrogen bond, which stabilizes its structure.Formula:C5H10N2OPurity:Min. 95%Molecular weight:114.15 g/molRef: 3D-FA162171
Discontinued product