CAS 552-59-0: 5-hydroxy-3-(4-hydroxyphenyl)-7-methoxy-4-benzopyrone
Formula:C16H12O5
InChI:InChI=1S/C16H12O5/c1-20-11-6-13(18)15-14(7-11)21-8-12(16(15)19)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3
InChI key:InChIKey=KQMVAGISDHMXJJ-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC(OC)=CC2O)OC=C1C3=CC=C(O)C=C3
Synonyms:- 4H-1-benzopyran-4-one, 5-hydroxy-3-(4-hydroxyphenyl)-7-methoxy-
- 5,4′-Dihydroxy-7-methoxyisoflavone
- 5-Hydroxy-3-(4-hydroxyphenyl)-7-methoxy-4H-1-benzopyran-4-one
- 5-Hydroxy-3-(4-hydroxyphenyl)-7-methoxy-4H-chromen-4-on
- 5-Hydroxy-3-(4-hydroxyphenyl)-7-methoxy-4H-chromen-4-one
- 7-O-Methylgenistein
- Isoflavone, 4′,5-dihydroxy-7-methoxy-
- Prunetin
- Prunusetin
Sort by
Found 12 products.
Prunetin
CAS:Prunetin analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C16H12O5Purity:(HPLC) ≥95%Color and Shape:PowderMolecular weight:284.28Prunetin
CAS:Prunetin reduces inflammation, mortality, obesity markers, and mucin secretion, while blocking NF-κB, ERK activation, and improving cellular barriers.Formula:C16H12O5Purity:98.43% - ≥95%Color and Shape:Creamy White Crystalline PowderMolecular weight:284.26Ref: TM-T4S0878
1mg47.00€5mg87.00€10mg153.00€25mg250.00€50mg369.00€100mg550.00€200mg787.00€1mL*10mM (DMSO)95.00€5-Hydroxy-3-(4-hydroxyphenyl)-7-methoxy-4H-chromen-4-one
CAS:Purity:95.0%Molecular weight:284.2669982910156Prunetin
CAS:Prunetin is a naturally occurring isoflavone, which is an organic compound derived from plant sources. It is primarily found in legumes and other plant materials where it naturally occurs as part of the plant's phytochemical arsenal. The mode of action of prunetin involves modulating various biochemical pathways, including acting as an antioxidant, influencing estrogenic activity, and affecting cellular signaling pathways. Its biochemical properties allow it to interact with multiple cellular targets, leading to its diverse biological activities. Prunetin is extensively studied for its potential applications in pharmacology and medicine. Its antioxidant properties make it a candidate for reducing oxidative stress-related cellular damage. Moreover, due to its phytoestrogenic capabilities, it is of interest in exploring treatments for hormone-related conditions. Additionally, its role in modulating signaling pathways hints at potential anti-inflammatory and anti-carcinogenic applications. Researchers continue to investigate the specific biochemical interactions and therapeutic potential of prunetin across various domains of health and disease.Formula:C16H12O5Purity:Min. 95%Color and Shape:Slightly Brown PowderMolecular weight:284.26 g/mol4H-1-Benzopyran-4-one, 5-hydroxy-3-(4-hydroxyphenyl)-7-methoxy-
CAS:Formula:C16H12O5Purity:95%Color and Shape:SolidMolecular weight:284.2635Prunetin; 7-O-Methylgenistein
CAS:Formula:C16H12O5Purity:88.62%Color and Shape:Brownish. SolidMolecular weight:284.0
