
CAS 5558-04-3: α-Cyclopropyl-α-methylbenzenemethanol
Formula:C11H14O
InChI:InChI=1S/C11H14O/c1-11(12,10-7-8-10)9-5-3-2-4-6-9/h2-6,10,12H,7-8H2,1H3
InChI key:InChIKey=ODESSVLMCLJHHD-UHFFFAOYSA-N
SMILES:C(C)(O)(C1CC1)C2=CC=CC=C2
Synonyms:- 1-Cyclopropyl-1-phenylethan-1-ol
- 1-Phenyl-1-cyclopropylethanol
- Benzenemethanol, α-cyclopropyl-α-methyl-
- Benzyl alcohol, α-cyclopropyl-α-methyl-
- NSC 77105
- alpha-Cyclopropyl-alpha-methylbenzyl alcohol~Cyclopropyl methyl phenyl carbinol
- α-Cyclopropyl-α-methylbenzenemethanol
- 1-Cyclopropyl-1-phenylethanol
Sort by
Found 3 products.
1-CYCLOPROPYL-1-PHENYLETHANOL
CAS:Formula:C11H14OPurity:95%Color and Shape:LiquidMolecular weight:162.228260000000061-Cyclopropyl-1-phenylethanol
CAS:1-Cyclopropyl-1-phenylethanol is a chemical that belongs to the group of oxidants. It is used in organic chemistry as a cleavage reagent and for the transformation of alkyl groups. Cyclopropyl phenols are readily obtained by oxidation of thiophenes with potassium permanganate in ethanol or ethanols. The mechanism of this reaction involves formation of a bond between the sulfur atom and the hydrogen atom on one side and the active oxygen atom on the other side. 1-Cyclopropyl-1-phenylethanol also has functional group properties, which make it suitable for use in cyclopropylation reactions.Formula:C11H14OPurity:Min. 95%Molecular weight:162.23 g/mol1-Phenyl-1-cyclopropyl ethanol
CAS:Purity:97.0%Color and Shape:LiquidMolecular weight:162.23199462890625