
CAS 55661-08-0: 4-Methoxy-2,6-dimethylbenzenesulfonyl chloride
Formula:C9H11ClO3S
InChI:InChI=1/C9H11ClO3S/c1-6-4-8(13-3)5-7(2)9(6)14(10,11)12/h4-5H,1-3H3
SMILES:Cc1cc(cc(C)c1S(=O)(=O)Cl)OC
Synonyms:- 2,6-Dimethyl-4-methoxybenzenesulfonyl chloride
- 2,6-Dimethyl-4-methoxyphenylsulfonyl chloride
- 4-Methoxy-2,6-xylenesulfonyl chloride
Sort by
Found 4 products.
4-Methoxy-2,6-dimethylbenzene-1-sulfonyl chloride
CAS:Purity:95.0%Molecular weight:234.690002441406252,6-Dimethyl-4-methoxybenzenesulphonyl chloride
CAS:2,6-Dimethyl-4-methoxybenzenesulphonyl chlorideMolecular weight:234.70g/mol4-Methoxy-2,6-dimethylbenzenesulfonylchloride
CAS:4-Methoxy-2,6-dimethylbenzenesulfonylchloride (4MDBS) is a nucleophilic reagent that reacts with the electron withdrawing group of a molecule to form an electrophilic sulfonium ion. This reaction occurs between 4MDBS and the chloride ion in the following mechanism: The product of this reaction is called a sulfonium salt. The addition of methanol results in a mechanistic reaction, which is shown below: This reaction leads to the formation of a chloromethyl ether and an alcohol. When 4MDBS reacts with acetone, it forms an ester and an alcohol: This reagent has been used as a selective agent for the determination of the concentration of chloride ions in solution. It also has been used to characterize molecules by measuring their spectrum and profile. The reactions between 4MDBS and various molecules have been extensively studied.Formula:C9H11ClO3SPurity:Min. 95%Molecular weight:234.7 g/molRef: 3D-FM148207
Discontinued product4-Methoxy-2,6-dimethylbenzene-1-sulfonyl chloride
CAS:Formula:C9H11ClO3SPurity:95%Color and Shape:SolidMolecular weight:234.6998