
CAS 55934-01-5: 2,4,5-Trichloropyridine
Formula:C5H2Cl3N
InChI:InChI=1S/C5H2Cl3N/c6-3-1-5(8)9-2-4(3)7/h1-2H
InChI key:InChIKey=ZJKMPIAMSJCNFI-UHFFFAOYSA-N
SMILES:ClC=1C(Cl)=CN=C(Cl)C1
Synonyms:- 2,4,5-Trichloropyridine
- Pyridine, 2,4,5-trichloro-
Sort by
Found 4 products.
2,4,5-Trichloropyridine
CAS:2,4,5-Trichloropyridine is a chemical compound that can be prepared by the industrialization of chloropyridine. It is typically made by reacting pyridine with chlorine in the presence of an alkali metal hydroxide such as sodium hydroxide. The reaction takes place in a solution of nitrobenzene and water, which is then evaporated to give 2,4,5-trichloropyridine crystals. This chemical can also be prepared by the evaporation of a solution of chloropyridine in an organic solvent like benzene or toluene. 2,4,5-Trichloropyridine can react with pyridine to form 2-chloro-4,5-dichloropyrimidine and 4-chloro-2,5-dichloropyrimidine. This reaction can be reversed by adding ammonia or ammonium chloride and heating the mixture to 100 degreesFormula:C5H2Cl3NPurity:Min. 95%Molecular weight:182.43 g/molRef: 3D-FT75021
Discontinued product2,4,5-Trichloropyridine
CAS:Formula:C5H2Cl3NPurity:95%Color and Shape:LiquidMolecular weight:182.4351