
CAS 56252-09-6: 2,3-dimethoxynaphthalene-1-carbaldehyde
Formula:C13H12O3
InChI:InChI=1/C13H12O3/c1-15-12-7-9-5-3-4-6-10(9)11(8-14)13(12)16-2/h3-8H,1-2H3
SMILES:COc1cc2ccccc2c(C=O)c1OC
Sort by
Found 2 products.
2,3-Dimethoxy-1-naphthaldehyde
CAS:2,3-Dimethoxy-1-naphthaldehyde is an aromatic compound that belongs to the group of benzene derivatives. It is a colorless liquid with a strong odor. This chemical has been used in organic chemistry as a reagent for the synthesis of naphthalenes, grignard reagents, pyrazolines, and anigozanthos. 2,3-Dimethoxy-1-naphthaldehyde has also been shown to be a potential anticancer drug. Its crystal structure has been determined and it was found to have a hydrogen bond between the oxygen atom and one of the methyl groups on the benzene ring. In addition, it can undergo photolysis under ultraviolet light and form both trimethylbenzene and dimethylbenzene.Formula:C13H12O3Purity:Min. 95%Molecular weight:216.23 g/mol