
CAS 56611-54-2: 3-cyclohexyl-1-methyl-6-(methylamino)-1,3,5-triazine-2,4(1H,3H)-dione
Formula:C11H18N4O2
InChI:InChI=1/C11H18N4O2/c1-12-9-13-10(16)15(11(17)14(9)2)8-6-4-3-5-7-8/h8H,3-7H2,1-2H3,(H,12,13,16)
SMILES:CN=c1nc(n(C2CCCCC2)c(=O)n1C)O
Sort by
Found 4 products.
N-Desmethyl Hexazinone
CAS:Controlled ProductFormula:C11H18N4O2Color and Shape:NeatMolecular weight:238.29Hexazinone metabolite B
CAS:Hexazinone metabolite B is a chemical byproduct of the breakdown of Hexazinone, which is an herbicide. This metabolite emerges from an extensive metabolic pathway in plants, fungi, and soil microorganisms as they degrade the parent compound. Its mode of action involves interacting with plant processes, potentially affecting growth and development, as it may influence photosynthetic pathways or other vital physiological functions. In scientific research, the study of Hexazinone metabolite B and similar metabolites helps elucidate the environmental fate of herbicides and their potential impacts on non-target organisms. Understanding these metabolic pathways is crucial for assessing the ecological risks associated with Hexazinone use and developing sustainable agricultural practices. Furthermore, the analysis of such metabolites can aid in optimizing the efficacy of herbicides by minimizing undesired effects on ecosystems.Formula:C11H18N4O2Purity:Min. 95%Molecular weight:238.29 g/mol