
CAS 56663-76-4: 2,2-Dimethyl-3-butynoic acid
Formula:C6H8O2
InChI:InChI=1S/C6H8O2/c1-4-6(2,3)5(7)8/h1H,2-3H3,(H,7,8)
InChI key:InChIKey=WCDPCILUMOPENA-UHFFFAOYSA-N
SMILES:C(C(O)=O)(C#C)(C)C
Synonyms:- 2,2-Dimethyl-3-butynoic acid
- 2,2-Dimethyl-but-3-ynoic acid
- 2,2-Dimethylbut-3-ynoic acid
- 2,2-Dimethylbut-3-ynoicacid
- 3-Butynoic acid, 2,2-dimethyl-
Sort by
Found 4 products.
2,2-Dimethylbut-3-ynoic acid
CAS:Purity:95.0%Color and Shape:LiquidMolecular weight:112.127998352050782,2-Dimethyl-3-butynoic acid
CAS:Formula:C6H8O2Purity:92%Color and Shape:LiquidMolecular weight:112.12652,2-Dimethylbut-3-ynoic acid
CAS:2,2-Dimethylbut-3-ynoic acid is an organic compound that can be synthesized from acetone. The chemical formula of this compound is C6H12O2. 2,2-Dimethylbut-3-ynoic acid has a boiling point of 157 degrees Celsius and a melting point of -87 degrees Celsius. It has the molecular weight of 136.19 g/mol and its density is 1.07 g/cm^3 at 25 degrees Celsius. This compound can be used as a precursor to other chemicals, such as butanediol or butyraldehyde, which are used in production processes for plastics and synthetic rubber.Formula:C6H8O2Purity:Min. 95%Molecular weight:112.13 g/mol