
CAS 5676-81-3: N-(4-Fluorobenzylidene)aniline
Formula:C13H10FN
InChI:InChI=1/C13H10FN/c14-12-8-6-11(7-9-12)10-15-13-4-2-1-3-5-13/h1-10H
SMILES:c1ccc(cc1)N=Cc1ccc(cc1)F
Sort by
Found 5 products.
N-(4-Fluorobenzylidene)Aniline
CAS:N-(4-Fluorobenzylidene)Aniline is a ligand that reacts with hydroboration to form an organometallic compound. It is used as a biomolecular oxidant in organic synthesis, and has been shown to be efficient in the oxidation of primary amines and carbonyl compounds. The reaction mechanism involves homoleptic N-(4-fluorobenzylidene)aniline binding to molecular oxygen to form an oxo-N-(4-fluorobenzylidene)aniline complex, which undergoes a 1,2-elimination reaction with the electron deficient substrate. This process leads to the formation of a nitroso compound, which is then reduced by another equivalent of molecular oxygen. The final product is formed from an intermediate nitroso compound and the substrate.Formula:C13H10FNPurity:Min. 95%Molecular weight:199.22 g/mol4-Fluorobenzylideneaniline
CAS:4-FluorobenzylideneanilineFormula:C13H10FNPurity:98%Color and Shape:Pale Yellow SolidMolecular weight:199.22g/molN-(4-FLUOROBENZYLIDENE)ANILINE
CAS:Formula:C13H10FNPurity:98%Color and Shape:SolidMolecular weight:199.2236N-(4-Fluorobenzylidene)aniline
CAS:Formula:C13H10FNPurity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:199.23