
CAS 569-80-2: Penduletin
Formula:C18H16O7
InChI:InChI=1S/C18H16O7/c1-22-12-8-11-13(14(20)17(12)23-2)15(21)18(24-3)16(25-11)9-4-6-10(19)7-5-9/h4-8,19-20H,1-3H3
InChI key:InChIKey=YSXFFLGRZJWNFM-UHFFFAOYSA-N
SMILES:O=C1C=2C(OC(=C1OC)C3=CC=C(O)C=C3)=CC(OC)=C(OC)C2O
Synonyms:- 4H-1-benzopyran-4-one, 5-hydroxy-2-(4-hydroxyphenyl)-3,6,7-trimethoxy-
- 4′,5-Dihydroxy-3,6,7-trimethoxyflavone
- 5,4′-Dihydroxy-3,6,7-trimethoxyflavone
- 5-Hydroxy-2-(4-hydroxyphenyl)-3,6,7-trimethoxy-4H-1-benzopyran-4-one
- 6-Hydroxykaempferol 3,6,7-trimethyl ether
- Flavone, 4′,5-dihydroxy-3,6,7-trimethoxy-
- Penduletin
Sort by
Found 5 products.
Penduletin
CAS:Penduletin is a flavonoid compound, which is a type of natural phenolic product, primarily sourced from various plant species. This compound occurs naturally as part of the plant's secondary metabolites and plays a crucial role in defense mechanisms. Penduletin exerts its effects primarily through its antioxidant activity, modulating various signaling pathways involved in cellular protection processes. It acts by scavenging free radicals and reducing oxidative stress, which is pivotal in its therapeutic applications. Penduletin is extensively studied for its potential anti-inflammatory and anticancer properties. Researchers have been exploring its ability to inhibit the proliferation of cancer cells and its role in apoptotic pathways. Additionally, its anti-inflammatory actions make it a promising candidate for managing chronic inflammatory conditions. By modulating key enzymes and signaling molecules involved in inflammatory responses, penduletin helps in reducing inflammation in various biological models. The comprehensive understanding of penduletin's mechanisms contributes to its potential as an adjunct in therapy regimes across various fields of medical and pharmaceutical sciences.Formula:C18H16O7Purity:Min. 95%Color and Shape:White PowderMolecular weight:344.32 g/molPenduletin
CAS:Oxygen-heterocyclic compoundFormula:C18H16O7Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:344.32Penduletin
CAS:Penduletin: anti-inflammatory, anti-tumor, anti-bacterial, inhibits neisseria gonorrhoeae, fights EV71 with low toxicity.Formula:C18H16O7Purity:98%Color and Shape:SolidMolecular weight:344.319