
CAS 56962-01-7: 3-Amino-2-chlorophenol
Formula:C6H6ClNO
InChI:InChI=1S/C6H6ClNO/c7-6-4(8)2-1-3-5(6)9/h1-3,9H,8H2
InChI key:InChIKey=CFWIOOCJVYJEID-UHFFFAOYSA-N
SMILES:ClC1=C(N)C=CC=C1O
Synonyms:- 2-Chloro-3-aminophenol
- 2-Chloro-3-hydroxyaniline
- Phenol, 3-amino-2-chloro-
- 3-Amino-2-chlorophenol
- 3-Amino-2-chlorophenol
Sort by
Found 4 products.
3-Amino-2-chlorophenol
CAS:Controlled ProductFormula:C6H6ClNOColor and Shape:NeatMolecular weight:143.5713-Amino-2-chlorophenol
CAS:3-Amino-2-chlorophenol (3AC) is a chemical compound that is found in the leaves of plants and some insects. 3AC has been shown to be an insecticide and has been used in various commercial products such as Invicta and Camphene. 3AC is also used to create other chemicals by substituting it into other chemical pathways. The synthesis of 3AC can be done in two ways: the direct substitution of chlorine with ammonia or the substitution of chlorine with cyclopentadiene. Each method yields different isomers, which are either R or S configurations.Formula:C6H6ClNOPurity:Min. 95%Molecular weight:143.57 g/molRef: 3D-FA152816
Discontinued product