CAS 56962-08-4: 4,5-Dichlorophthalic acid
Formula:C8H4Cl2O4
InChI:InChI=1S/C8H4Cl2O4/c9-5-1-3(7(11)12)4(8(13)14)2-6(5)10/h1-2H,(H,11,12)(H,13,14)
InChI key:InChIKey=FDOQKGWUMUEJLX-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C(O)=O)C=C(Cl)C(Cl)=C1
Synonyms:- 1,2-Benzenedicarboxylic acid, 4,5-dichloro-
- 4,5-Dichloro-1,2-benzenedicarboxylic acid
- 4,5-Dichloro-2-carboxybenzoic acid
- 4,5-Dichlorobenzene-1,2-Dicarboxylic Acid
- 4,5-Dichlorophthalic acid
Sort by
Found 5 products.
4,5-Dichlorophthalic Acid
CAS:Formula:C8H4Cl2O4Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:235.024,5-DICHLOROPHTHALIC ACID
CAS:Formula:C8H4Cl2O4Purity:96%Color and Shape:SolidMolecular weight:235.0214,5-Dichlorophthalic acid
CAS:Purity:95.0%Color and Shape:Solid, CrystallineMolecular weight:235.020004272460944,5-Dichlorophthalic acid
CAS:4,5-Dichlorophthalic acid is a dibasic acid that can be used to produce polycarboxylic acids and phthalimides. It is a colorless solid that reacts with water in the presence of oxygen or other oxidizing agents to form hydrogen chloride. The reaction yields of 4,5-dichlorophthalic acid are dependent on the concentration of proton donor. The optical properties of 4,5-dichlorophthalic acid are determined by its intramolecular hydrogen bond and its substructures. The molecule has an acylation reaction with diisopropylamine to form 4,5-dichlorophthaloyl chloride. This product also undergoes dehydration reactions to produce hexamethylenetetramine and phthalimides. Hydrogen bonds between 4,5-dichlorophthalic acid and water molecules are broken during these reactions, which may lead to the formationFormula:C8H4Cl2O4Purity:Min. 95%Molecular weight:235.02 g/molRef: 3D-FD34979
Discontinued product
