
CAS 57822-06-7: 5-Oxoazelaic acid
Formula:C9H14O5
InChI:InChI=1S/C9H14O5/c10-7(3-1-5-8(11)12)4-2-6-9(13)14/h1-6H2,(H,11,12)(H,13,14)
InChI key:InChIKey=GTCHZEFRDKAINX-UHFFFAOYSA-N
SMILES:C(CCCC(O)=O)(CCCC(O)=O)=O
Synonyms:- 5-Oxononanedioic acid
- NSC 134496
- Nonanedioic acid, 5-oxo-
- Nsc 111667
- 5-Oxoazelaic acid
Sort by
Found 5 products.
5-Oxoazelaic acid
CAS:5-Oxoazelaic acid is a stable organic compound that belongs to the class of organic acids. It is a symmetrical molecule with two carbon atoms and four oxygen atoms. The chemical stability of 5-Oxoazelaic acid is due to the carbonyl group in its structure, which can react with electrophilic compounds such as water, alcohols and amines. 5-Oxoazelaic acid has been shown to be more reactive than a fatty acid because it can lose a hydrogen atom from the carbonyl group when reacting with an electrophile, while fatty acids cannot. 5-Oxoazelaic acid is produced by the oxidation of undecane, which is an anthropogenic product.Formula:C9H14O5Purity:Min. 95%Molecular weight:202.2 g/mol5-Oxoazelaic Acid
CAS:Formula:C9H14O5Purity:>96.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:202.21