
CAS 579-92-0: 2,2′-Iminodibenzoic acid
Formula:C14H11NO4
InChI:InChI=1S/C14H11NO4/c16-13(17)9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)14(18)19/h1-8,15H,(H,16,17)(H,18,19)
InChI key:InChIKey=ZFRNOTZQUGWMQN-UHFFFAOYSA-N
SMILES:N(C1=C(C(O)=O)C=CC=C1)C2=C(C(O)=O)C=CC=C2
Synonyms:- Benzoic acid, 2,2′-iminodi-
- Diphenylamine-2,2′-dicarboxylic acid
- Benzoic acid, o,o′-iminodi-
- Benzoic acid, 2,2′-iminobis-
- 2,2′-Iminobis[benzoic acid]
Sort by
Found 5 products.
2,2'-Azanediyldibenzoic Acid
CAS:Formula:C14H11NO4Purity:>95.0%(T)(HPLC)Color and Shape:White to Brown powder to crystalMolecular weight:257.252,2'-IMINODIBENZOIC ACID
CAS:Formula:C14H11NO4Purity:98%Color and Shape:SolidMolecular weight:257.24142,2²-Iminodibenzoic acid
CAS:2,2²-Iminodibenzoic acid is a strong acid that is used in the synthesis of other compounds. It has been shown to have cytotoxic effects on cells, leading to the death of cancer cells. 2,2²-Iminodibenzoic acid binds to metal ions and may act as an antioxidant by donating hydrogen atoms. This compound also inhibits cellular camp, which is an enzyme that converts chloride into bicarbonate ions. 2,2²-Iminodibenzoic acid is synthesized by reacting benzene with nitric acid and hydrochloric acid. The reaction produces a mixture of chlorobenzene and nitrobenzene, which are then reacted with hydrochloric acid again to produce 2,2²-Iminodibenzoic acid. 2,2²-Iminodibenzoic acid has been shown to be effective in treating various types of cancer through its ability to inhibitFormula:C14H11NO4Purity:Min. 95%Molecular weight:257.24 g/mol