
CAS 57964-39-3: 4-(1-cyanoethyl)-1,2,3,4-tetrahydronaphthalene-1-carbonitrile
Formula:C14H14N2
InChI:InChI=1/C14H14N2/c1-10(8-15)12-7-6-11(9-16)13-4-2-3-5-14(12)13/h2-5,10-12H,6-7H2,1H3
SMILES:CC(C#N)C1CCC(C#N)c2ccccc12
Synonyms:- 1-Naphthaleneacetonitrile, 4-cyano-1,2,3,4-tetrahydro-alpha-methyl-
- 2-[1-(4-Cyano-1,2,3,4-tetrahydronaphthyl)]propanenitrile
- 4-(1-Cyanoethyl)-1,2,3,4-tetrahydro-1-naphthalenecarbonitrile
- 4-Cyano-1,2,3,4-tetrahydro-alpha-methyl-1-naphthaleneacetonitrile
- Styrene-acrylonitrile trimer
Sort by
Found 3 products.
4-(1-Cyanoethyl)-1,2,3,4-tetrahydronaphthalene-1-carbonitrile
CAS:Formula:C14H14N2Molecular weight:210.284-(1-Cyanoethyl)-1,2,3,4-tetrahydronaphthalene-1-carbonitrile
CAS:4-(1-Cyanoethyl)-1,2,3,4-tetrahydronaphthalene-1-carbonitrile is a synthetic organic compound, typically utilized in advanced chemical research and development. It is derived through a multi-step synthetic process involving the manipulation of naphthalene derivatives. The compound is characterized by the presence of cyano groups, influencing its reactivity and potential for further chemical transformations. With its unique structure, 4-(1-Cyanoethyl)-1,2,3,4-tetrahydronaphthalene-1-carbonitrile acts primarily through specific interactions at the molecular level, allowing researchers to explore its potential in various synthetic pathways. These interactions are of particular interest in the study of carbon-carbon bond formations and other complex organic synthesis mechanisms. Applications of this compound are mainly found within the realm of chemical research labs, where it serves as an intermediate or starting material for the synthesis of more complex molecules. Its reactivity and structural properties make it valuable for the development of novel pharmaceuticals, agrochemicals, and advanced materials. Researchers appreciate its role in expanding the toolkit of functionalized naphthalene derivatives, contributing to the synthesis of compounds with significant industrial and therapeutic potential.Formula:C14H14N2Purity:Min. 95%Molecular weight:210.27 g/mol4-(1-Cyanoethyl)-1,2,3,4-tetrahydronaphthalene-1-carbonitrile
CAS:Applications 4-(1-Cyanoethyl)-1,2,3,4-tetrahydronaphthalene-1-carbonitrile is a component of the crude extract resulting from studies on the antifungal activity of Citrullus colocynthis against various plant pathogenic fungi.Oligomeric product in thermal polymerization of acrylonitrile/styrene system. References Bokhari, N.A., et al.: J Pure Appl Microbio, 7, 2981-2986 (2013);Kirchner, K. et al. Macromolek Chem, 1976, 177, 2031-42.Formula:C14H14N2Color and Shape:White To Light YellowMolecular weight:210.27